| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| S358149-1mg | 1mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $697.90 |
| Synonyms | Salbutamon | 156547-62-5 | Albuterone | Salbutamone | Salbutamol Impurity J | UNII-T0IO19163J | T0IO19163J | 2-(tert-butylamino)-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone | DTXSID60166095 | 2-((1,1-Dimethylethyl)amino)-1-(4-hydroxy-3-(hydroxymethyl)phenyl)ethanone | Etha |
|---|---|
| Shipped In | Normal |
| IUPAC Name | 2-(tert-butylamino)-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone |
|---|---|
| INCHI | InChI=1S/C13H19NO3/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15/h4-6,14-16H,7-8H2,1-3H3 |
| InChi Key | WHJAFZHZZCVHJI-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)NCC(=O)C1=CC(=C(C=C1)O)CO |
| Isomeric SMILES | CC(C)(C)NCC(=O)C1=CC(=C(C=C1)O)CO |
| PubChem CID | 11601134 |
| Molecular Weight | 282.81 |
Enter Lot Number to search for COA:
