| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| S195214-250mg | 250mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $2,930.90 |
| Synonyms | Sodium 2,4-difluorobenzoate | 1765-08-8 | 83198-07-6 | sodium;2,4-difluorobenzoate | SODIUM2,4-DIFLUOROBENZOATE | Benzoic acid, 2,4-difluoro-, sodium salt | Benzoic acid, 2,4-difluoro-, sodium salt (1:1) | Benzoic acid,2,4-difluoro-, sodium salt (1:1) | AMY8871 | DTXSID901 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| IUPAC Name | sodium;2,4-difluorobenzoate |
|---|---|
| INCHI | InChI=1S/C7H4F2O2.Na/c8-4-1-2-5(7(10)11)6(9)3-4;/h1-3H,(H,10,11);/q;+1/p-1 |
| InChi Key | ZNMYMPIKSTUKOB-UHFFFAOYSA-M |
| Canonical SMILES | C1=CC(=C(C=C1F)F)C(=O)[O-].[Na+] |
| Isomeric SMILES | C1=CC(=C(C=C1F)F)C(=O)[O-].[Na+] |
| PubChem CID | 23687225 |
| Molecular Weight | 180.08 |
Enter Lot Number to search for COA:
