| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| T356064-5mg | 5mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $697.90 |
| Synonyms | Cefepime Impurity C | (Z)-2-(2-aminothiazol-4-yl)-2-(methoxyimino)-N-(2-oxoethyl)acetamide | THR 221V | UNII-S2EPB812P8 | CEFEPIME DIHYDROCHLORIDE MONOHYDRATE IMPURITY C [EP IMPURITY] | S2EPB812P8 | T 2588G | J-001143 | T-2588G | Cefepime dihydrochloride |
|---|---|
| Storage Temp | Store at -20°C |
| Shipped In | Ice chest + Ice pads |
| IUPAC Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-(2-oxoethyl)acetamide |
|---|---|
| INCHI | InChI=1S/C8H10N4O3S/c1-15-12-6(7(14)10-2-3-13)5-4-16-8(9)11-5/h3-4H,2H2,1H3,(H2,9,11)(H,10,14)/b12-6- |
| InChi Key | NZKHCGFKLHLKCP-SDQBBNPISA-N |
| Canonical SMILES | CON=C(C1=CSC(=N1)N)C(=O)NCC=O |
| Isomeric SMILES | CO/N=C(/C1=CSC(=N1)N)\C(=O)NCC=O |
| PubChem CID | 14312738 |
| Molecular Weight | 346.32 |
Enter Lot Number to search for COA:
| Melt Point(°C) | >240° C (dec.) |
|---|
