| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| T162736-250mg | 250mg | In stock | $112.90 | |
| T162736-1g | 1g | In stock | $346.90 |
| Synonyms | 4-ISOPROPYLCYCLOHEXANOL|trans-4-Isopropylcyclohexanol|4621-04-9|15890-36-5|4-iso-Propylcyclohexanol|cis-4-isopropylcyclohexanol|22900-08-9|Cyclohexanol, 4-(1-methylethyl)-|Cyclohexanol, 4-(1-methylethyl)-, trans-|Cyclohexanol, 4-isopropyl-|p-Isopropylcycl |
|---|---|
| Specifications & Purity | ≥93% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In | Wet ice |
| IUPAC Name | 4-propan-2-ylcyclohexan-1-ol |
|---|---|
| INCHI | InChI=1S/C9H18O/c1-7(2)8-3-5-9(10)6-4-8/h7-10H,3-6H2,1-2H3 |
| InChi Key | DKKRDMLKVSKFMJ-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)C1CCC(CC1)O |
| Isomeric SMILES | CC(C)C1CCC(CC1)O |
| PubChem CID | 20739 |
| Molecular Weight | 142.24 |
| Beilstein | 6(3)112 |
| Reaxy-Rn | 2322224 |
Enter Lot Number to search for COA:
| Sensitivity | Moisture sensitive |
|---|---|
| Refractive Index | 1.47 |
| Flash Point(°C) | 81 °C |
| Boil Point(°C) | 94°C/5mmHg(lit.) |
| Melt Point(°C) | 6°C(lit.) |
| Pictogram(s) | GHS05 |
|---|---|
| Signal | Danger |
| Hazard Statements | H318:Causes serious eye damage |
| Precautionary Statements | P280:Wear protective gloves/protective clothing/eye protection/face protection. P264+P265:Wash hands [and …] thoroughly after handling. Do not touch eyes. P305+P354+P338:IF IN EYES: Immediately rinse with water for several minutes. Remove contact lenses if present and easy to do. Continue rinsing. P317:Get emergency medical help. |
| Reaxy-Rn | 2322224 |
Starting at $71.90
C2311606