| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| T342190-100g | 100g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $475.90 |
| Synonyms | 274257-37-3 | Tributylmethylammonium methyl carbonate | N,N-Dibutyl-N-methylbutan-1-aminium methyl carbonate | Methyltributylammonium methyl carbonate | SCHEMBL2230485 | DTXSID20584832 | MFCD09265058 | methyl carbonate;tributyl(methyl)azanium |
|---|---|
| Specifications & Purity | ~50% in methanol: water (2:3) |
| Shipped In | Normal |
| IUPAC Name | methyl carbonate;tributyl(methyl)azanium |
|---|---|
| INCHI | InChI=1S/C13H30N.C2H4O3/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;1-5-2(3)4/h5-13H2,1-4H3;1H3,(H,3,4)/q+1;/p-1 |
| InChi Key | ZKWSMHMGQLTZGI-UHFFFAOYSA-M |
| Canonical SMILES | CCCC[N+](C)(CCCC)CCCC.COC(=O)[O-] |
| Isomeric SMILES | CCCC[N+](C)(CCCC)CCCC.COC(=O)[O-] |
| WGK Germany | 3 |
| PubChem CID | 16218239 |
| UN Number | 1987 |
| Packing Group | III |
| Molecular Weight | 275.43 |
Enter Lot Number to search for COA:
| Flash Point(°F) | 134.6 °F |
|---|---|
| Flash Point(°C) | 57 °C |
| Signal | Danger |
|---|---|
| Hazard Statements | H226:Flammable liquid and vapor H370:Causes damage to organs H302+H312+H332:Harmful if swallowed, in contact with skin or if inhaled |
| Precautionary Statements | P280:Wear protective gloves/protective clothing/eye protection/face protection. P260:Do not breathe dust/fume/gas/mist/vapors/spray. P307+P311:IF exposed: call a POISON CENTER or doctor/physician. |
| WGK Germany | 3 |
| Class | 3 |
| RIDADR | UN1987C3/PGIII |
