| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| Z671156-1mg | 1mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $999.90 |
| Synonyms | Zomax | D06382 | 1H-Pyrrole-2-acetic acid, 5-(4-chlorobenzoyl)-1,4-dimethyl-, sodium salt, dihydrate | Zomepirac sodium dihydrate | DTXSID60214282 | Zomaxin | 1H-PYRROLE-2-ACETIC ACID, 5-(4-CHLOROBENZOYL)-1,4-DIMETHYL-, SODIUM SALT, HYDRATE (1:1:2) | sodi |
|---|
| IUPAC Name | sodium;2-[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]acetate;dihydrate |
|---|---|
| INCHI | InChI=1S/C15H14ClNO3.Na.2H2O/c1-9-7-12(8-13(18)19)17(2)14(9)15(20)10-3-5-11(16)6-4-10;;;/h3-7H,8H2,1-2H3,(H,18,19);;2*1H2/q;+1;;/p-1 |
| InChi Key | ZJXLSCXDGPDZOL-UHFFFAOYSA-M |
| Canonical SMILES | CC1=C(N(C(=C1)CC(=O)[O-])C)C(=O)C2=CC=C(C=C2)Cl.O.O.[Na+] |
| Isomeric SMILES | CC1=C(N(C(=C1)CC(=O)[O-])C)C(=O)C2=CC=C(C=C2)Cl.O.O.[Na+] |
| PubChem CID | 23663418 |
| Molecular Weight | 349.74 |
Enter Lot Number to search for COA:
