The store will not work correctly when cookies are disabled.
1-(2-phenylethyl)-1H-indole-2,3-dione , CAS No.41042-17-5
Basic Description
Synonyms | 1-(2-phenylethyl)-1H-indole-2,3-dione | 1-(2-phenylethyl)indole-2,3-dione | 1-(2-phenylethyl)-2,3-dihydro-1H-indole-2,3-dione | 1-phenethylindoline-2,3-dione | 1-Phenethyl-1H-indole-2,3-dione | 1-(2-Phenylethyl)isatin | CBMicro_013192 | DTXSID201313648 | |
---|
Associated Targets(Human)
Names and Identifiers
IUPAC Name | 1-(2-phenylethyl)indole-2,3-dione |
INCHI | InChI=1S/C16H13NO2/c18-15-13-8-4-5-9-14(13)17(16(15)19)11-10-12-6-2-1-3-7-12/h1-9H,10-11H2 |
InChi Key | XICVNIWRISOITG-UHFFFAOYSA-N |
Canonical SMILES | C1=CC=C(C=C1)CCN2C3=CC=CC=C3C(=O)C2=O |
Isomeric SMILES | C1=CC=C(C=C1)CCN2C3=CC=CC=C3C(=O)C2=O |
PubChem CID | 1894707 |
Molecular Weight | 251.28 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator