The store will not work correctly when cookies are disabled.
1-((3-Bromo-4-methoxyphenyl)sulfonyl)-4-methylpiperidine , CAS No.443668-51-7
Basic Description
Synonyms | 1-((3-bromo-4-methoxyphenyl)sulfonyl)-4-methylpiperidine | 1-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylpiperidine | MLS000062013 | 1-[(3-bromo-4-methoxyphenyl)sulfonyl]-4-methylpiperidine | SMR000070875 | Oprea1_595698 | Oprea1_837299 | cid_846306 | BDBM4 |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 1-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylpiperidine |
INCHI | InChI=1S/C13H18BrNO3S/c1-10-5-7-15(8-6-10)19(16,17)11-3-4-13(18-2)12(14)9-11/h3-4,9-10H,5-8H2,1-2H3 |
InChi Key | WUFYBGATQFSDDE-UHFFFAOYSA-N |
Canonical SMILES | CC1CCN(CC1)S(=O)(=O)C2=CC(=C(C=C2)OC)Br |
Isomeric SMILES | CC1CCN(CC1)S(=O)(=O)C2=CC(=C(C=C2)OC)Br |
PubChem CID | 846306 |
Molecular Weight | 348.26 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator