The store will not work correctly when cookies are disabled.
1-(3-Iodobenzyl)guanidine hemisulfate - 97%, high purity , CAS No.87862-25-7
Basic Description
| Synonyms | 87862-25-7 | Iobenguane sulfate | m-Iodobenzylguanidine hemisulfate | MIBG | 1-(3-Iodobenzyl)guanidine hemisulfate | Iobenguane sulphate | m-Iodobenzyl guanidine sulfate | MIBG (sulfate) | 3-Iodobenzyl-guanidine sulfate | m-Iodobenzyl guanidine sulphate | 3-Iodobenzyl-guanid |
|---|
| Specifications & Purity | ≥97% |
|---|
| Storage Temp | Store at 2-8°C,Protected from light,Argon charged |
|---|
| Shipped In | Wet ice |
|---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
| IUPAC Name | 2-[(3-iodophenyl)methyl]guanidine;sulfuric acid |
|---|
| INCHI | InChI=1S/2C8H10IN3.H2O4S/c2*9-7-3-1-2-6(4-7)5-12-8(10)11;1-5(2,3)4/h2*1-4H,5H2,(H4,10,11,12);(H2,1,2,3,4) |
|---|
| InChi Key | XNACDNPGABUBFR-UHFFFAOYSA-N |
|---|
| Canonical SMILES | C1=CC(=CC(=C1)I)CN=C(N)N.C1=CC(=CC(=C1)I)CN=C(N)N.OS(=O)(=O)O |
|---|
| Isomeric SMILES | C1=CC(=CC(=C1)I)CN=C(N)N.C1=CC(=CC(=C1)I)CN=C(N)N.OS(=O)(=O)O |
|---|
| PubChem CID | 11957572 |
|---|
| Molecular Weight | 324.13 |
|---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator
