| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| I182751-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $54.90 | |
| I182751-5g | 5g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $184.90 |
| Synonyms | 21244-34-8 | 1-(4-isopropoxyphenyl)methanamine | 4-isopropoxybenzylamine | (4-isopropoxyphenyl)methanamine | (4-propan-2-yloxyphenyl)methanamine | [4-(propan-2-yloxy)phenyl]methanamine | MFCD04037892 | 4-(Isopropoxy)benzylamine | 4-Isopropoxy-benzylamine | 4-[(Prop-2-yl)ox |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | (4-propan-2-yloxyphenyl)methanamine |
|---|---|
| INCHI | InChI=1S/C10H15NO/c1-8(2)12-10-5-3-9(7-11)4-6-10/h3-6,8H,7,11H2,1-2H3 |
| InChi Key | BHCAOBYOKNTDLI-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)OC1=CC=C(C=C1)CN |
| Isomeric SMILES | CC(C)OC1=CC=C(C=C1)CN |
| PubChem CID | 2760936 |
| Molecular Weight | 165.2 |
| Molecular Weight | 165.230 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 3 |
| Exact Mass | 165.115 Da |
| Monoisotopic Mass | 165.115 Da |
| Topological Polar Surface Area | 35.300 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 117.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
