The store will not work correctly when cookies are disabled.
1-benzyl-5-chloro-2,3-dihydro-1H-indole-2,3-dione , CAS No.26960-68-9
Basic Description
Synonyms | 1-benzyl-5-chloro-1H-indole-2,3-dione | 1-benzyl-5-chloro-2,3-dihydro-1H-indole-2,3-dione | 1-benzyl-5-chloroindole-2,3-dione | 1-benzyl-5-chloroindoline-2,3-dione | CCPOUFJZMAONLI-UHFFFAOYSA-N | BBA96068 | BDBM50133625 | MFCD02315132 | STK394567 | AKOS00 |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 1-benzyl-5-chloroindole-2,3-dione |
INCHI | InChI=1S/C15H10ClNO2/c16-11-6-7-13-12(8-11)14(18)15(19)17(13)9-10-4-2-1-3-5-10/h1-8H,9H2 |
InChi Key | CCPOUFJZMAONLI-UHFFFAOYSA-N |
Canonical SMILES | C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)Cl)C(=O)C2=O |
Isomeric SMILES | C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)Cl)C(=O)C2=O |
PubChem CID | 3704739 |
Molecular Weight | 271.7 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator