The store will not work correctly when cookies are disabled.
1-Ethyl-3-(4-methoxyphenyl)-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione , CAS No.144294-65-5
Basic Description
Synonyms | 1-Ethyl-3-(4-methoxyphenyl)-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione | Oprea1_738262 | DNDI1318588 | BDBM50420474 | STK249722 | AKOS001873421 | CCG-144083 | 144294-65-5 | SR-01000432322 | SR-01000432322-1 | D052-0169 |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 1-ethyl-3-(4-methoxyphenyl)-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
INCHI | InChI=1S/C15H15N5O3/c1-4-20-13-11(14(21)19(2)15(22)17-13)16-12(18-20)9-5-7-10(23-3)8-6-9/h5-8H,4H2,1-3H3 |
InChi Key | OYEOXFZRVNDRKZ-UHFFFAOYSA-N |
Canonical SMILES | CCN1C2=NC(=O)N(C(=O)C2=NC(=N1)C3=CC=C(C=C3)OC)C |
Isomeric SMILES | CCN1C2=NC(=O)N(C(=O)C2=NC(=N1)C3=CC=C(C=C3)OC)C |
PubChem CID | 906558 |
Molecular Weight | 313.31 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator