The store will not work correctly when cookies are disabled.
1-Pentyl-1H-indole-2,3-dione , CAS No.4290-90-8
Basic Description
Synonyms | 4290-90-8 | 1-Pentyl-1H-indole-2,3-dione | 1-Pentylindoline-2,3-dione | 1-pentylindole-2,3-dione | 1-pentyl-2,3-dihydro-1H-indole-2,3-dione | CHEMBL3128209 | 1-pentyl isatin | SCHEMBL281625 | DTXSID30364501 | UGVPQGQPUANQSX-UHFFFAOYSA-N | BDBM50448806 | MFCD00224228 | STL577262 | |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Associated Targets(Human)
Names and Identifiers
IUPAC Name | 1-pentylindole-2,3-dione |
INCHI | InChI=1S/C13H15NO2/c1-2-3-6-9-14-11-8-5-4-7-10(11)12(15)13(14)16/h4-5,7-8H,2-3,6,9H2,1H3 |
InChi Key | UGVPQGQPUANQSX-UHFFFAOYSA-N |
Canonical SMILES | CCCCCN1C2=CC=CC=C2C(=O)C1=O |
Isomeric SMILES | CCCCCN1C2=CC=CC=C2C(=O)C1=O |
PubChem CID | 1581092 |
Molecular Weight | 217.27 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator