The store will not work correctly when cookies are disabled.
17-Deoxyestradiol , CAS No.53-63-4
Basic Description
Synonyms | 17-Deoxyestradiol | 17-Desoxyestradiol | 17-Deoxyestrone | Deoxoestrone | Estrone, 17-deoxy- | 3-Hydroxyestra-1,3,5(10)-triene | 17-Deoxyoestrone | ESTRA-1,3,5(10)-TRIEN-3-OL | 17-deoxoestrone | 17-Desoxyestrone | estra-1(10),2,4-trien-3-ol | OESTRA-1,3,5 |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | (8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
INCHI | InChI=1S/C18H24O/c1-18-9-2-3-17(18)16-6-4-12-11-13(19)5-7-14(12)15(16)8-10-18/h5,7,11,15-17,19H,2-4,6,8-10H2,1H3/t15-,16-,17+,18+/m1/s1 |
InChi Key | HJKVPZJVBHWFCQ-BDXSIMOUSA-N |
Canonical SMILES | CC12CCCC1C3CCC4=C(C3CC2)C=CC(=C4)O |
Isomeric SMILES | C[C@@]12CCC[C@H]1[C@@H]3CCC4=C([C@H]3CC2)C=CC(=C4)O |
PubChem CID | 5888 |
Molecular Weight | 256.399 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator