The store will not work correctly when cookies are disabled.
1H-Indole-3-ethanamine, 4-methoxy- , CAS No.3610-35-3
Basic Description
Synonyms | 4-Methoxytryptamine | 2-(4-methoxy-1H-indol-3-yl)ethanamine | 1H-Indole-3-ethanamine, 4-methoxy- | 2-(4-methoxy-1H-indol-3-yl)ethan-1-amine | 4-Methoxy-1H-indole-3-ethanamine | DTXSID70189679 | WMBARRJMPVVQEZ-UHFFFAOYSA-N | BDBM50025223 | MFCD03848075 | A |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 2-(4-methoxy-1H-indol-3-yl)ethanamine |
INCHI | InChI=1S/C11H14N2O/c1-14-10-4-2-3-9-11(10)8(5-6-12)7-13-9/h2-4,7,13H,5-6,12H2,1H3 |
InChi Key | WMBARRJMPVVQEZ-UHFFFAOYSA-N |
Canonical SMILES | COC1=CC=CC2=C1C(=CN2)CCN |
Isomeric SMILES | COC1=CC=CC2=C1C(=CN2)CCN |
PubChem CID | 19219 |
Molecular Weight | 190.24 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator