The store will not work correctly when cookies are disabled.
2,3,5,6-tetramethyl-7H-furo[3,2-g]chromen-7-one , CAS No.374703-24-9
Basic Description
Synonyms | 2,3,5,6-tetramethyl-7H-furo[3,2-g]chromen-7-one | 2,3,5,6-tetramethylfuro[3,2-g]chromen-7-one | Oprea1_079868 | BDBM50236900 | STL456985 | AKOS001666869 | EU-0047930 | AS-871/42121744 | SR-01000112080 | SR-01000112080-1 |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 2,3,5,6-tetramethylfuro[3,2-g]chromen-7-one |
INCHI | InChI=1S/C15H14O3/c1-7-8(2)15(16)18-14-6-13-12(5-11(7)14)9(3)10(4)17-13/h5-6H,1-4H3 |
InChi Key | WXJJMJBXWVJLTL-UHFFFAOYSA-N |
Canonical SMILES | CC1=C(C(=O)OC2=CC3=C(C=C12)C(=C(O3)C)C)C |
Isomeric SMILES | CC1=C(C(=O)OC2=CC3=C(C=C12)C(=C(O3)C)C)C |
PubChem CID | 707707 |
Molecular Weight | 242.27 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator