The store will not work correctly when cookies are disabled.
2,4,6-cycloheptatrien-1-one, 2,3-dihydroxy-5-(1-methylethyl)- - 97%, high purity , CAS No.29346-20-1
Basic Description
Synonyms | 29346-20-1 | 2,3-Dihydroxy-5-isopropylcyclohepta-2,4,6-trienone | beta-Thujaplicinol | 2,4,6-Cycloheptatrien-1-one, 2,3-dihydroxy-5-(1-methylethyl)- | 4356-35-8 | ss-Thujaplicinol | 2,7-Dihydroxy-4-isopropylcyclohepta-2,4,6-trien-1-one | .beta.-Thujaplicinol | NSC18806 | 2 |
Specifications & Purity | 97% |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 2,3-dihydroxy-6-propan-2-ylcyclohepta-2,4,6-trien-1-one |
INCHI | InChI=1S/C10H12O3/c1-6(2)7-3-4-8(11)10(13)9(12)5-7/h3-6H,1-2H3,(H2,11,12,13) |
InChi Key | HVGNSPLLPQWYGC-UHFFFAOYSA-N |
Canonical SMILES | CC(C)C1=CC(=O)C(=C(C=C1)O)O |
Isomeric SMILES | CC(C)C1=CC(=O)C(=C(C=C1)O)O |
PubChem CID | 72605 |
Molecular Weight | 180.203 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator