The store will not work correctly when cookies are disabled.
2-(4-Methoxyphenoxy)benzonitrile - 98%, high purity , CAS No.171771-88-3
Basic Description
Synonyms | 2-(4-methoxyphenoxy)benzonitrile | 2-(4-methoxyphenoxy)benzenecarbonitrile | 171771-88-3 | Bionet2_000595 | Oprea1_512160 | MLS000720936 | CHEMBL1604849 | SCHEMBL22169508 | DTXSID101325816 | HMS1365L01 | HMS2699M19 | WGA77188 | MFCD02082665 | AKOS000261534 | SMR000335482 | CS-0213476 | |
Specifications & Purity | ≥98% |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 2-(4-methoxyphenoxy)benzonitrile |
INCHI | InChI=1S/C14H11NO2/c1-16-12-6-8-13(9-7-12)17-14-5-3-2-4-11(14)10-15/h2-9H,1H3 |
InChi Key | POUCYJIZEHTDSO-UHFFFAOYSA-N |
Canonical SMILES | COC1=CC=C(C=C1)OC2=CC=CC=C2C#N |
Isomeric SMILES | COC1=CC=C(C=C1)OC2=CC=CC=C2C#N |
PubChem CID | 2767824 |
Molecular Weight | 225.2 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator