The store will not work correctly when cookies are disabled.
{2-[(5-tert-Butyl-2-methyl-furan-3-carbonyl)-amino]-acetylamino}-acetic acid , CAS No.352560-89-5
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 2-[[2-[(5-tert-butyl-2-methylfuran-3-carbonyl)amino]acetyl]amino]acetic acid |
INCHI | InChI=1S/C14H20N2O5/c1-8-9(5-10(21-8)14(2,3)4)13(20)16-6-11(17)15-7-12(18)19/h5H,6-7H2,1-4H3,(H,15,17)(H,16,20)(H,18,19) |
InChi Key | HUZDCZIRBTZJNL-UHFFFAOYSA-N |
Canonical SMILES | CC1=C(C=C(O1)C(C)(C)C)C(=O)NCC(=O)NCC(=O)O |
Isomeric SMILES | CC1=C(C=C(O1)C(C)(C)C)C(=O)NCC(=O)NCC(=O)O |
PubChem CID | 645395 |
Molecular Weight | 296.33 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator