The store will not work correctly when cookies are disabled.
2-naphthalen-2-yl-4,5-dihydro-1H-imidazole , CAS No.113698-36-5
Basic Description
Synonyms | 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole | 2-(naphthalen-2-yl)-4,5-dihydro-1H-imidazole | DTXSID8048442 | BGWRJAXPPYHIRG-UHFFFAOYSA-N | BDBM50240366 |
---|
Associated Targets(Human)
Names and Identifiers
IUPAC Name | 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole |
INCHI | InChI=1S/C13H12N2/c1-2-4-11-9-12(6-5-10(11)3-1)13-14-7-8-15-13/h1-6,9H,7-8H2,(H,14,15) |
InChi Key | BGWRJAXPPYHIRG-UHFFFAOYSA-N |
Canonical SMILES | C1CN=C(N1)C2=CC3=CC=CC=C3C=C2 |
Isomeric SMILES | C1CN=C(N1)C2=CC3=CC=CC=C3C=C2 |
PubChem CID | 11769428 |
Molecular Weight | 196.25 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator