The store will not work correctly when cookies are disabled.
2-Phenoxynaphthalene-1,4-dione , CAS No.220459-72-3
Basic Description
Synonyms | 2-phenoxynaphthalene-1,4-dione | Multitarget ligand B6 | phenoxynaphthoquinone | DTXSID40578672 | BDBM50114360 | 2-phenoxy-1,4-dihydronaphthalene-1,4-dione |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 2-phenoxynaphthalene-1,4-dione |
INCHI | InChI=1S/C16H10O3/c17-14-10-15(19-11-6-2-1-3-7-11)16(18)13-9-5-4-8-12(13)14/h1-10H |
InChi Key | UCWKLNZSXHXPMB-UHFFFAOYSA-N |
Canonical SMILES | C1=CC=C(C=C1)OC2=CC(=O)C3=CC=CC=C3C2=O |
Isomeric SMILES | C1=CC=C(C=C1)OC2=CC(=O)C3=CC=CC=C3C2=O |
PubChem CID | 15828698 |
Molecular Weight | 250.25 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator