The store will not work correctly when cookies are disabled.
3-(1-adamantyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine , CAS No.327093-42-5
Basic Description
Synonyms | 3-(1-adamantyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine | MERCK-544 | Merck 544 | 11ss-HSD1 inhibitor 544 | 3-(Adamantan-1-yl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine | Compound 544 | Oprea1_175789 | DTXSID40394475 | HMS3745K09 | B |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 3-(1-adamantyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
INCHI | InChI=1S/C17H25N3/c1-2-4-15-18-19-16(20(15)5-3-1)17-9-12-6-13(10-17)8-14(7-12)11-17/h12-14H,1-11H2 |
InChi Key | VFTQRHWULYJKCI-UHFFFAOYSA-N |
Canonical SMILES | C1CCC2=NN=C(N2CC1)C34CC5CC(C3)CC(C5)C4 |
Isomeric SMILES | C1CCC2=NN=C(N2CC1)C34CC5CC(C3)CC(C5)C4 |
PubChem CID | 3630776 |
Molecular Weight | 271.4 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator