The store will not work correctly when cookies are disabled.
3′-Azido-2′-deoxyguanosine , CAS No.66323-46-4
Basic Description
Synonyms | 3'-Azido-2',3'-dideoxyguanosine | 66323-46-4 | 3'-AZIDO-2'-3'-DIDEOXYGUANOSINE | 3'-Azido-ddG | Guanosine, 3'-azido-2',3'-dideoxy- | 2-AMINO-9-[(2R,4S,5S)-4-AZIDO-5-(HYDROXYMETHYL)OXOLAN-2-YL]-1H-PURIN-6-ONE | AZddGuo | 3'-N3ddG | CHEMBL578448 | SCHEMBL15643042 | RFS-457 | A85 |
Shipped In | Normal |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 2-amino-9-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
INCHI | InChI=1S/C10H12N8O3/c11-10-14-8-7(9(20)15-10)13-3-18(8)6-1-4(16-17-12)5(2-19)21-6/h3-6,19H,1-2H2,(H3,11,14,15,20)/t4-,5+,6+/m0/s1 |
InChi Key | HETOJIJPBJGZFJ-KVQBGUIXSA-N |
Canonical SMILES | C1C(C(OC1N2C=NC3=C2N=C(NC3=O)N)CO)N=[N+]=[N-] |
Isomeric SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(NC3=O)N)CO)N=[N+]=[N-] |
PubChem CID | 135433653 |
Molecular Weight | 292.25 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator