The store will not work correctly when cookies are disabled.
3-Bromo-2-piperazinopyridine - 98%, high purity , CAS No.87394-56-7
Basic Description
Synonyms | 1-(3-Bromopyridin-2-yl)piperazine | 87394-56-7 | 3-Bromo-2-piperazinopyridine | CHEMBL295921 | 1-(3-Bromo-pyridin-2-yl)-piperazine | SCHEMBL2415357 | DTXSID60535565 | KYMBSIUPQJYAFF-UHFFFAOYSA-N | AMY32957 | BDBM50027013 | GS0765 | MFCD09910225 | AKOS010630963 | BS-25831 | CS-020576 |
Specifications & Purity | ≥98% |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 1-(3-bromopyridin-2-yl)piperazine |
INCHI | InChI=1S/C9H12BrN3/c10-8-2-1-3-12-9(8)13-6-4-11-5-7-13/h1-3,11H,4-7H2 |
InChi Key | KYMBSIUPQJYAFF-UHFFFAOYSA-N |
Canonical SMILES | C1CN(CCN1)C2=C(C=CC=N2)Br |
Isomeric SMILES | C1CN(CCN1)C2=C(C=CC=N2)Br |
PubChem CID | 13298529 |
Molecular Weight | 242.1 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator