The store will not work correctly when cookies are disabled.
3-Bromo-5-phenyl-4,5-dihydroisoxazole - 95%, high purity , CAS No.86256-88-4
Basic Description
| Synonyms | 3-Bromo-5-phenyl-4,5-dihydroisoxazole | 86256-88-4 | 3-bromo-5-phenyl-4,5-dihydro-1,2-oxazole | 3-bromo-5-phenylisoxazoline | SCHEMBL1169872 | CHEMBL3329247 | LNXKJBBQEFYTQV-UHFFFAOYSA- | DTXSID50530226 | LNXKJBBQEFYTQV-UHFFFAOYSA-N | MFCD11707003 | AKOS015836087 | BS-24210 | PD |
|---|
| Specifications & Purity | ≥95% |
|---|
| Shipped In | Normal |
|---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
| IUPAC Name | 3-bromo-5-phenyl-4,5-dihydro-1,2-oxazole |
|---|
| INCHI | InChI=1S/C9H8BrNO/c10-9-6-8(12-11-9)7-4-2-1-3-5-7/h1-5,8H,6H2 |
|---|
| InChi Key | LNXKJBBQEFYTQV-UHFFFAOYSA-N |
|---|
| Canonical SMILES | C1C(ON=C1Br)C2=CC=CC=C2 |
|---|
| Isomeric SMILES | C1C(ON=C1Br)C2=CC=CC=C2 |
|---|
| PubChem CID | 13228169 |
|---|
| Molecular Weight | 226.1 |
|---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator
