The store will not work correctly when cookies are disabled.
3-Chloro-2-(4-methylpiperazino)pyridine - 98%, high purity , CAS No.87394-57-8
Basic Description
Synonyms | 87394-57-8 | 1-(3-Chloropyridin-2-yl)-4-methylpiperazine | 3-Chloro-2-(4-methylpiperazino)pyridine | 3-CHLORO-2-(4-METHYLPIPERAZIN-1-YL)PYRIDINE | CHEMBL47415 | SCHEMBL13722300 | DTXSID80474785 | BDBM50027014 | MFCD07781228 | AKOS015848903 | AB42617 | BS-23084 | CS-0456777 | FT-07 |
Specifications & Purity | ≥98% |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 1-(3-chloropyridin-2-yl)-4-methylpiperazine |
INCHI | InChI=1S/C10H14ClN3/c1-13-5-7-14(8-6-13)10-9(11)3-2-4-12-10/h2-4H,5-8H2,1H3 |
InChi Key | FNMDXKBBBVNQQT-UHFFFAOYSA-N |
Canonical SMILES | CN1CCN(CC1)C2=C(C=CC=N2)Cl |
Isomeric SMILES | CN1CCN(CC1)C2=C(C=CC=N2)Cl |
PubChem CID | 11959098 |
Molecular Weight | 211.7 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator