The store will not work correctly when cookies are disabled.
[4-(1H-Pyrrol-1-yl)phenyl]methanol , CAS No.143426-51-1
Basic Description
Synonyms | [4-(1H-Pyrrol-1-yl)phenyl]methanol | 143426-51-1 | (4-(1H-Pyrrol-1-yl)phenyl)methanol | (4-pyrrol-1-ylphenyl)methanol | 4-(1H-Pyrrol-1-yl)benzyl alcohol | CHEMBL4244103 | 1-(4-Hydroxymethylphenyl)pyrrole | 4-(1H-Pyrrol-1-yl)benzylalcohol | F4K | Benzenemethanol,4-(1H-pyrro |
Shipped In | Normal |
---|
Associated Targets(Human)
Names and Identifiers
IUPAC Name | (4-pyrrol-1-ylphenyl)methanol |
INCHI | InChI=1S/C11H11NO/c13-9-10-3-5-11(6-4-10)12-7-1-2-8-12/h1-8,13H,9H2 |
InChi Key | LQQQPLUFBVYLRE-UHFFFAOYSA-N |
Canonical SMILES | C1=CN(C=C1)C2=CC=C(C=C2)CO |
Isomeric SMILES | C1=CN(C=C1)C2=CC=C(C=C2)CO |
PubChem CID | 599478 |
Molecular Weight | 173.22 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator