The store will not work correctly when cookies are disabled.
4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoic Acid , CAS No.207279-23-0
Basic Description
Synonyms | 4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoic Acid | ISK95MWA33 | 4-(8-(3-nitrophenyl)-1,7-naphthyridin-6-yl)benzoic acid | Benzoic acid, 4-(8-(3-nitrophenyl)-1,7-naphthyridin-6-yl)- | NPV | UNII-ISK95MWA33 | DTXSID80433973 | BDBM50085135 | DB08299 | |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoic acid |
INCHI | InChI=1S/C21H13N3O4/c25-21(26)14-8-6-13(7-9-14)18-12-16-4-2-10-22-19(16)20(23-18)15-3-1-5-17(11-15)24(27)28/h1-12H,(H,25,26) |
InChi Key | QTNUWEKKZHSUQO-UHFFFAOYSA-N |
Canonical SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=C3C(=CC(=N2)C4=CC=C(C=C4)C(=O)O)C=CC=N3 |
Isomeric SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=C3C(=CC(=N2)C4=CC=C(C=C4)C(=O)O)C=CC=N3 |
PubChem CID | 9999276 |
Molecular Weight | 371.3 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator