The store will not work correctly when cookies are disabled.
Basic Description
Specifications & Purity | ≥98% |
---|
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-methoxychromen-4-one |
INCHI | InChI=1S/C16H12O6/c1-21-15-12(20)6-10(18)14-11(19)7-13(22-16(14)15)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3 |
InChi Key | OEZZJTAJYYSQKM-UHFFFAOYSA-N |
Canonical SMILES | COC1=C(C=C(C2=C1OC(=CC2=O)C3=CC=C(C=C3)O)O)O |
Isomeric SMILES | COC1=C(C=C(C2=C1OC(=CC2=O)C3=CC=C(C=C3)O)O)O |
Alternate CAS | 57096-02-3 |
PubChem CID | 5322078 |
MeSH Entry Terms | 5,7,4'-trihydroxy-8-methoxyflavone |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator