The store will not work correctly when cookies are disabled.
4-[(Phenylsulfanyl)methyl]aniline , CAS No.13738-70-0
Basic Description
Synonyms | 4-[(phenylsulfanyl)methyl]aniline | 13738-70-0 | 4-((Phenylthio)methyl)aniline | 4-[(Phenylthio)methyl]aniline | 4-(phenylsulfanylmethyl)aniline | p-Toluidine, alpha-(phenylthio)- | Benzenamine, 4-[(phenylthio)methyl]- | MLS002694949 | .alpha.-(Phenylthio)-p-toluidine | Be |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 4-(phenylsulfanylmethyl)aniline |
INCHI | InChI=1S/C13H13NS/c14-12-8-6-11(7-9-12)10-15-13-4-2-1-3-5-13/h1-9H,10,14H2 |
InChi Key | BETHGEVRYKIURN-UHFFFAOYSA-N |
Canonical SMILES | C1=CC=C(C=C1)SCC2=CC=C(C=C2)N |
Isomeric SMILES | C1=CC=C(C=C1)SCC2=CC=C(C=C2)N |
PubChem CID | 96784 |
Molecular Weight | 215.31 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator