| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| C181762-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $37.90 | |
| C181762-5g | 5g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $184.90 | |
| C181762-25g | 25g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $843.90 |
| Synonyms | AMY6286 | WUVNWFZJNYBPIJ-UHFFFAOYSA-N | 5-Chloro-3-methylpyridine-2-carbonitrile | AB71756 | BL007508 | 5-Chloro-2-cyano-3-methylpyridine | CS-W022353 | FT-0762128 | SY031485 | 5-Chloro-3-methylpicolinonitrile | FS-3674 | 2-Pyridinecarbonitrile, 5-chloro- |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | 5-chloro-3-methylpyridine-2-carbonitrile |
|---|---|
| INCHI | InChI=1S/C7H5ClN2/c1-5-2-6(8)4-10-7(5)3-9/h2,4H,1H3 |
| InChi Key | WUVNWFZJNYBPIJ-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=CN=C1C#N)Cl |
| Isomeric SMILES | CC1=CC(=CN=C1C#N)Cl |
| PubChem CID | 21864563 |
| Molecular Weight | 152.6 |
| Molecular Weight | 152.580 g/mol |
|---|---|
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 152.014 Da |
| Monoisotopic Mass | 152.014 Da |
| Topological Polar Surface Area | 36.700 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 160.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
