The store will not work correctly when cookies are disabled.
5-nitro-2-phenoxybenzonitrile , CAS No.63707-35-7
Basic Description
Synonyms | 5-nitro-2-phenoxybenzonitrile | 63707-35-7 | Benzonitrile, 5-nitro-2-phenoxy- | N-Cbz-2-piperidineaceticAcid | CHEMBL137345 | SCHEMBL6052442 | 5-Nitro-2-phenoxy-benzonitrile | DTXSID70213120 | FRGNJGLFPJYGLU-UHFFFAOYSA-N | MFCD04491072 | STK501381 | AKOS000321582 | AKOS015941271 |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 5-nitro-2-phenoxybenzonitrile |
INCHI | InChI=1S/C13H8N2O3/c14-9-10-8-11(15(16)17)6-7-13(10)18-12-4-2-1-3-5-12/h1-8H |
InChi Key | FRGNJGLFPJYGLU-UHFFFAOYSA-N |
Canonical SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)[N+](=O)[O-])C#N |
Isomeric SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)[N+](=O)[O-])C#N |
PubChem CID | 514846 |
Molecular Weight | 240.22 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator