The store will not work correctly when cookies are disabled.
5-(Pyridin-3-yl)thiophene-2-carbaldehyde , CAS No.133531-43-8
Basic Description
Synonyms | 5-(Pyridin-3-yl)thiophene-2-carbaldehyde | 5-pyridin-3-ylthiophene-2-carbaldehyde | 5-(3-PYRIDINYL)-2-THIOPHENECARBALDEHYDE | 5-Pyridin-3-yl-thiophene-2-carbaldehyde | DTXSID20447635 | DIQWXENHCURRML-UHFFFAOYSA-N | BDBM50158916 | AKOS004113158 | MS-22100 |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 5-pyridin-3-ylthiophene-2-carbaldehyde |
INCHI | InChI=1S/C10H7NOS/c12-7-9-3-4-10(13-9)8-2-1-5-11-6-8/h1-7H |
InChi Key | DIQWXENHCURRML-UHFFFAOYSA-N |
Canonical SMILES | C1=CC(=CN=C1)C2=CC=C(S2)C=O |
Isomeric SMILES | C1=CC(=CN=C1)C2=CC=C(S2)C=O |
PubChem CID | 10899427 |
Molecular Weight | 189.24 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator