The store will not work correctly when cookies are disabled.
6-Chloro-α-(3-methylphenyl)-3-pyridazineacetonitrile , CAS No.339008-33-2
Basic Description
Synonyms | 339008-33-2 | 2-(6-chloropyridazin-3-yl)-2-(m-tolyl)acetonitrile | 2-(6-chloropyridazin-3-yl)-2-(3-methylphenyl)acetonitrile | 2-(6-chloro-3-pyridazinyl)-2-(3-methylphenyl)acetonitrile | MLS000692115 | SMR000333793 | 6-Chloro-alpha-(3-methylphenyl)-3-pyridazineaceton |
Shipped In | Normal |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 2-(6-chloropyridazin-3-yl)-2-(3-methylphenyl)acetonitrile |
INCHI | InChI=1S/C13H10ClN3/c1-9-3-2-4-10(7-9)11(8-15)12-5-6-13(14)17-16-12/h2-7,11H,1H3 |
InChi Key | CTRXOKALOFTXKD-UHFFFAOYSA-N |
Canonical SMILES | CC1=CC(=CC=C1)C(C#N)C2=NN=C(C=C2)Cl |
Isomeric SMILES | CC1=CC(=CC=C1)C(C#N)C2=NN=C(C=C2)Cl |
PubChem CID | 6409738 |
Molecular Weight | 243.7 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator