The store will not work correctly when cookies are disabled.
6-(Dipropylamino)-5,6,7,8-tetrahydronaphthalene-1,2-diol , CAS No.64309-39-3
Basic Description
Synonyms | 6-(dipropylamino)-5,6,7,8-tetrahydronaphthalene-1,2-diol | 2-(N,N-dipropyl)amino-5,6-dihydroxytetralin | TL 102 (Pharmaceutical) | N,N-Dipropyl-5,6-adtn | 5,6-Dihydroxy-2-N,N-dipropylaminotetralin | DTXSID90982861 | BDBM50026553 | PDSP1_000012 | PDSP1_000 |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 6-(dipropylamino)-5,6,7,8-tetrahydronaphthalene-1,2-diol |
INCHI | InChI=1S/C16H25NO2/c1-3-9-17(10-4-2)13-6-7-14-12(11-13)5-8-15(18)16(14)19/h5,8,13,18-19H,3-4,6-7,9-11H2,1-2H3 |
InChi Key | JQHSYAQISCFWOK-UHFFFAOYSA-N |
Canonical SMILES | CCCN(CCC)C1CCC2=C(C1)C=CC(=C2O)O |
Isomeric SMILES | CCCN(CCC)C1CCC2=C(C1)C=CC(=C2O)O |
PubChem CID | 122167 |
Molecular Weight | 263.37 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator