The store will not work correctly when cookies are disabled.
8,13(15)-Abietadienoic Acid , CAS No.19402-33-6
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | (1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-ylidene-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid |
INCHI | InChI=1S/C20H30O2/c1-13(2)14-6-8-16-15(12-14)7-9-17-19(16,3)10-5-11-20(17,4)18(21)22/h17H,5-12H2,1-4H3,(H,21,22)/t17-,19-,20-/m1/s1 |
InChi Key | SYMPSTMTYSPKHY-MISYRCLQSA-N |
Canonical SMILES | CC(=C1CCC2=C(C1)CCC3C2(CCCC3(C)C(=O)O)C)C |
Isomeric SMILES | CC(=C1CCC2=C(C1)CC[C@@H]3[C@@]2(CCC[C@@]3(C)C(=O)O)C)C |
PubChem CID | 11543995 |
Molecular Weight | 302.45 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator