The store will not work correctly when cookies are disabled.
8-Acetylamino-3a,4,5,9b-tetrahydro-3H-cyclopenta-[c]quinoline-4-carboxylic acid , CAS No.347362-65-6
Product Properties
ALogP | 1.118 |
HBD Count | 2 |
Rotatable Bond | 2 |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 8-acetamido-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid |
INCHI | InChI=1S/C15H16N2O3/c1-8(18)16-9-5-6-13-12(7-9)10-3-2-4-11(10)14(17-13)15(19)20/h2-3,5-7,10-11,14,17H,4H2,1H3,(H,16,18)(H,19,20) |
InChi Key | QLBLLPHHKLJIQF-UHFFFAOYSA-N |
Canonical SMILES | CC(=O)NC1=CC2=C(C=C1)NC(C3C2C=CC3)C(=O)O |
Isomeric SMILES | CC(=O)NC1=CC2=C(C=C1)NC(C3C2C=CC3)C(=O)O |
PubChem CID | 3115075 |
Molecular Weight | 272.29914 |
---|
Chemical and Physical Properties
DMSO(mM) Max Solubility | 10 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator