The store will not work correctly when cookies are disabled.
8-Methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid , CAS No.247225-89-4
Basic Description
Synonyms | 8-Methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid | 247225-89-4 | MLS-0111571.0001 | 8-Methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta [c]quinoline-4-carboxylic acid | CBMicro_008705 | Cambridge id 5798227 | Oprea1_525459 | Oprea1_781197 | CHEMBL15279 |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 8-methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid |
INCHI | InChI=1S/C14H15NO3/c1-18-8-5-6-12-11(7-8)9-3-2-4-10(9)13(15-12)14(16)17/h2-3,5-7,9-10,13,15H,4H2,1H3,(H,16,17) |
InChi Key | UZSOIZZSGQKUTA-UHFFFAOYSA-N |
Canonical SMILES | COC1=CC2=C(C=C1)NC(C3C2C=CC3)C(=O)O |
Isomeric SMILES | COC1=CC2=C(C=C1)NC(C3C2C=CC3)C(=O)O |
PubChem CID | 3122746 |
Molecular Weight | 245.28 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator