The store will not work correctly when cookies are disabled.
Anhydro Pridinol Hydrochloride , CAS No.13150-57-7
Basic Description
Synonyms | 13150-57-7 | Piperidine, 1-(3,3-diphenylallyl)- | Anhydro Pridinol Hydrochloride | 1-(3,3-diphenylprop-2-enyl)piperidine | CHEMBL2332280 | 1-(3,3-DIPHENYLPROP-2-EN-1-YL)PIPERIDINE | Sch 1926 | 1-(3,3-Diphenylallyl)piperidine | BRN 0209071 | 1-(3,3-diphenyl-2-propenyl)piper |
Shipped In | Normal |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 1-(3,3-diphenylprop-2-enyl)piperidine |
INCHI | InChI=1S/C20H23N/c1-4-10-18(11-5-1)20(19-12-6-2-7-13-19)14-17-21-15-8-3-9-16-21/h1-2,4-7,10-14H,3,8-9,15-17H2 |
InChi Key | MOCURCBRVYTAME-UHFFFAOYSA-N |
Canonical SMILES | C1CCN(CC1)CC=C(C2=CC=CC=C2)C3=CC=CC=C3 |
Isomeric SMILES | C1CCN(CC1)CC=C(C2=CC=CC=C2)C3=CC=CC=C3 |
PubChem CID | 202718 |
Molecular Weight | 313.86 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator