The store will not work correctly when cookies are disabled.
Benzamide, N-2-benzothiazolyl-4-nitro- , CAS No.35353-21-0
Basic Description
Synonyms | Benzamide, N-2-benzothiazolyl-4-nitro- | N-(1,3-benzothiazol-2-yl)-4-nitrobenzamide | n-(benzo[d]thiazol-2-yl)-4-nitrobenzamide | BRN 0556225 | N-2-Benzothiazolyl-4-nitrobenzamide | Oprea1_181766 | Oprea1_524403 | DTXSID70188844 | GOKOILBJPWVKQU-UHFFFAOYS |
---|
Names and Identifiers
IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-nitrobenzamide |
INCHI | InChI=1S/C14H9N3O3S/c18-13(9-5-7-10(8-6-9)17(19)20)16-14-15-11-3-1-2-4-12(11)21-14/h1-8H,(H,15,16,18) |
InChi Key | GOKOILBJPWVKQU-UHFFFAOYSA-N |
Canonical SMILES | C1=CC=C2C(=C1)N=C(S2)NC(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Isomeric SMILES | C1=CC=C2C(=C1)N=C(S2)NC(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
PubChem CID | 215271 |
Molecular Weight | 299.31 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator