The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8987314, B64 ID: ALA3672654
PubChem CID: 89969703
Max Phase: Preclinical
Molecular Formula: C22H26N4O8S3
Molecular Weight: 570.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCOC(=O)Nc1ccc(-c2ccc3nc(C(C(=O)NCCS(N)(=O)=O)S(C)(=O)=O)sc3c2)cc1
Standard InChI: InChI=1S/C22H26N4O8S3/c1-33-10-11-34-22(28)25-16-6-3-14(4-7-16)15-5-8-17-18(13-15)35-21(26-17)19(36(2,29)30)20(27)24-9-12-37(23,31)32/h3-8,13,19H,9-12H2,1-2H3,(H,24,27)(H,25,28)(H2,23,31,32)
Standard InChI Key: OWODJORZYXWNRK-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
10.1091 -10.3762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0720 -9.7724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0765 -8.2716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7795 -7.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7840 -6.0157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4870 -5.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4458 -5.8570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -3.7597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1047 -0.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8532 -1.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2514 -2.3421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.3541 -1.3071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.1026 -2.6079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.6034 -2.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3519 -3.9119 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-11.5519 -3.9144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.9499 -4.9523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.7501 -4.9501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.8601 1.2937 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-7.0601 1.2899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4636 2.3310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2637 2.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 18 1 0
22 23 2 0
23 15 1 0
20 24 1 0
24 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
30 32 2 0
30 33 1 0
24 34 1 0
34 35 2 0
34 36 2 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 570.67Molecular Weight (Monoisotopic): 570.0913AlogP: 1.65#Rotatable Bonds: 11Polar Surface Area: 183.85Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.48CX Basic pKa: ┄CX LogP: 0.41CX LogD: 0.14Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -1.44
References 1. (2015) Amide, urea or sulfone amide linked benzothiazole inhibitors of endothelial lipase,