The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8987314, B379 ID: ALA3682491
PubChem CID: 89962104
Max Phase: Preclinical
Molecular Formula: C20H22N4O6S3
Molecular Weight: 510.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1cccc(-c2ccc3sc(C(C(=O)NCCS(N)(=O)=O)S(C)(=O)=O)nc3c2)c1
Standard InChI: InChI=1S/C20H22N4O6S3/c1-12(25)23-15-5-3-4-13(10-15)14-6-7-17-16(11-14)24-20(31-17)18(32(2,27)28)19(26)22-8-9-33(21,29)30/h3-7,10-11,18H,8-9H2,1-2H3,(H,22,26)(H,23,25)(H2,21,29,30)
Standard InChI Key: ZPUQKDZSPUYPSK-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
1.5496 -5.3964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5868 -5.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5825 -7.1998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8888 -5.2533 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1047 -0.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8532 -1.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2514 -2.3421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.3541 -1.3071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.1026 -2.6079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.6034 -2.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3519 -3.9119 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-11.5519 -3.9144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.9499 -4.9523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.7501 -4.9501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.8601 1.2937 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-7.0601 1.2899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4636 2.3310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2637 2.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
9 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 14 1 0
18 19 2 0
19 11 1 0
16 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
26 28 2 0
26 29 1 0
20 30 1 0
30 31 2 0
30 32 2 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.62Molecular Weight (Monoisotopic): 510.0701AlogP: 1.41#Rotatable Bonds: 8Polar Surface Area: 165.39Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.48CX Basic pKa: ┄CX LogP: -0.17CX LogD: -0.43Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -1.61
References 1. (2015) Amide, urea or sulfone amide linked benzothiazole inhibitors of endothelial lipase,