rac-1-(4-(4-((3S,4R)-4-(dimethylamino)-1-(7-fluoro-2,3-dihydro-1H-inden-1-yl)pyrrolidin-3-yl)phenyl)piperazin-1-yl)ethanone

ID: ALA4060827

PubChem CID: 132085494

Max Phase: Preclinical

Molecular Formula: C27H35FN4O

Molecular Weight: 450.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N1CCN(c2ccc([C@H]3CN(C4CCc5cccc(F)c54)C[C@@H]3N(C)C)cc2)CC1

Standard InChI:  InChI=1S/C27H35FN4O/c1-19(33)30-13-15-31(16-14-30)22-10-7-20(8-11-22)23-17-32(18-26(23)29(2)3)25-12-9-21-5-4-6-24(28)27(21)25/h4-8,10-11,23,25-26H,9,12-18H2,1-3H3/t23-,25?,26+/m1/s1

Standard InChI Key:  HONKOMBKMLYRBQ-XWYQMZBESA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   21.0219   -9.4297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2787   -8.6455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6093   -8.1587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1968   -9.4297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9446   -8.6465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1420   -8.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5906   -9.0852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8476   -9.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6497  -10.0381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8882   -7.6897    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.6076   -7.3337    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2720   -6.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0153   -6.0648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1902   -6.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9370   -6.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4988   -5.3963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3195   -5.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1616   -4.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7037   -5.4002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0414   -4.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5558   -3.9846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7345   -4.0724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4013   -4.8318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8891   -5.4946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2485   -3.4049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5836   -2.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1000   -1.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2789   -2.0709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9439   -2.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4298   -3.4959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7941   -1.4033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1299   -0.6497    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9736   -1.4894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
  1  2  1  0
  2  3  1  0
  3  5  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  6 10  1  0
  3 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 13 16  1  1
 16 17  1  0
 16 18  1  0
 14 19  1  6
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 25 26  1  0
 25 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 22 25  1  0
 28 31  1  0
 31 32  2  0
 31 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4060827

    ---

Associated Targets(Human)

EED Tchem Polycomb protein EED (645 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Pfeiffer (261 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Liver (8163 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.60Molecular Weight (Monoisotopic): 450.2795AlogP: 3.51#Rotatable Bonds: 4
Polar Surface Area: 30.03Molecular Species: BASEHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.25CX LogP: 3.36CX LogD: 1.52
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.71Np Likeness Score: -0.81

References

1. Curtin ML, Pliushchev MA, Li HQ, Torrent M, Dietrich JD, Jakob CG, Zhu H, Zhao H, Wang Y, Ji Z, Clark RF, Sarris KA, Selvaraju S, Shaw B, Algire MA, He Y, Richardson PL, Sweis RF, Sun C, Chiang GG, Michaelides MR..  (2017)  SAR of amino pyrrolidines as potent and novel protein-protein interaction inhibitors of the PRC2 complex through EED binding.,  27  (7): [PMID:28254486] [10.1016/j.bmcl.2017.02.030]
2. Wang Y, Edalji RP, Panchal SC, Sun C, Djuric SW, Vasudevan A..  (2017)  Are We There Yet? Applying Thermodynamic and Kinetic Profiling on Embryonic Ectoderm Development (EED) Hit-to-Lead Program.,  60  (20): [PMID:28926243] [10.1021/acs.jmedchem.7b00576]
3. Martin MC,Zeng G,Yu J,Schiltz GE.  (2020)  Small Molecule Approaches for Targeting the Polycomb Repressive Complex 2 (PRC2) in Cancer.,  63  (24.0): [PMID:33283516] [10.1021/acs.jmedchem.0c01344]

Source