1-(4-(4-((3S,4R)-4-(Dimethylamino)-1-((S)-7-fluoro-2,3-dihydro-1H-inden-1-yl)pyrrolidin-3-yl)phenyl)piperazin-1-yl)ethanone

ID: ALA4084398

PubChem CID: 132085608

Max Phase: Preclinical

Molecular Formula: C27H35FN4O

Molecular Weight: 450.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N1CCN(c2ccc([C@H]3CN([C@H]4CCc5cccc(F)c54)C[C@@H]3N(C)C)cc2)CC1

Standard InChI:  InChI=1S/C27H35FN4O/c1-19(33)30-13-15-31(16-14-30)22-10-7-20(8-11-22)23-17-32(18-26(23)29(2)3)25-12-9-21-5-4-6-24(28)27(21)25/h4-8,10-11,23,25-26H,9,12-18H2,1-3H3/t23-,25+,26+/m1/s1

Standard InChI Key:  HONKOMBKMLYRBQ-AFESJLNVSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   15.7510   -6.6311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0080   -7.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5355   -8.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0196   -8.7282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7954   -8.4712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7905   -7.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4483   -7.1691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1971   -7.4962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3571   -6.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7716   -9.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2963   -6.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0398   -5.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2387   -5.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6946   -5.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9540   -6.4718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9807   -4.3083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2580  -10.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7818  -10.8275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0029  -10.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0006   -9.7675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2947   -9.3638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5906   -9.7740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5970  -10.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3034  -10.9922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2914   -8.5466    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.5280   -3.6994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2729   -2.9268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4729   -2.7584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9284   -3.3690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1838   -4.1480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2178   -1.9821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7625   -1.3729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4179   -1.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  2  1  0
  6  7  1  1
  7  8  1  0
  7  9  1  0
 10  4  1  1
  1 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15  1  1  0
 13 16  1  0
 10 20  1  0
 19 18  1  0
 17 10  1  0
 17 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 21 25  1  0
 16 26  1  0
 16 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 28 31  1  0
 31 32  2  0
 31 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4084398

    ---

Associated Targets(Human)

EED Tchem Polycomb protein EED (645 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.60Molecular Weight (Monoisotopic): 450.2795AlogP: 3.51#Rotatable Bonds: 4
Polar Surface Area: 30.03Molecular Species: BASEHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.25CX LogP: 3.36CX LogD: 1.52
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.71Np Likeness Score: -0.81

References

1. Wang Y, Edalji RP, Panchal SC, Sun C, Djuric SW, Vasudevan A..  (2017)  Are We There Yet? Applying Thermodynamic and Kinetic Profiling on Embryonic Ectoderm Development (EED) Hit-to-Lead Program.,  60  (20): [PMID:28926243] [10.1021/acs.jmedchem.7b00576]

Source