The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2'-(4-Carbamimidoylphenylcarbamoyl)-4'-(4-(hydroxymethyl)thiophen-3-yl)-4-(isobutylcarbamoyl)biphenyl-2-carboxylic acid ID: ALA502293
PubChem CID: 44592831
Max Phase: Preclinical
Molecular Formula: C31H30N4O5S
Molecular Weight: 570.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CNC(=O)c1ccc(-c2ccc(-c3cscc3CO)cc2C(=O)Nc2ccc(C(=N)N)cc2)c(C(=O)O)c1
Standard InChI: InChI=1S/C31H30N4O5S/c1-17(2)13-34-29(37)20-6-10-24(26(12-20)31(39)40)23-9-5-19(27-16-41-15-21(27)14-36)11-25(23)30(38)35-22-7-3-18(4-8-22)28(32)33/h3-12,15-17,36H,13-14H2,1-2H3,(H3,32,33)(H,34,37)(H,35,38)(H,39,40)
Standard InChI Key: RSIRPNPAPRYLFZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
11.1684 -1.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1684 -0.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4540 -0.3557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7395 -0.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7395 -1.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4540 -2.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4540 0.4693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1684 0.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1684 1.7068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4540 2.1193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7395 1.7068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7395 0.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4540 2.9443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1684 3.3568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7395 3.3568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7395 4.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0250 4.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0250 5.4193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3106 4.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8829 0.4693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5974 0.8818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8829 -0.3557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0250 -0.3557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0250 0.4693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3106 -0.7682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3106 -1.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0250 -2.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0250 -2.8307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3106 -3.2432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5961 -2.8307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5961 -2.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3106 -4.0682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0250 -4.4807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5961 -4.4807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4540 -2.8307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1214 -3.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8665 -4.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0415 -4.1003 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.7865 -3.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9060 -3.0607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5191 -3.6128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8 20 1 0
2 3 1 0
20 21 2 0
10 11 1 0
20 22 1 0
5 6 2 0
4 23 1 0
11 12 2 0
23 24 2 0
12 7 1 0
23 25 1 0
3 7 1 0
25 26 1 0
6 1 1 0
26 27 2 0
10 13 1 0
27 28 1 0
1 2 2 0
28 29 2 0
13 14 2 0
29 30 1 0
3 4 2 0
30 31 2 0
31 26 1 0
13 15 1 0
29 32 1 0
7 8 2 0
32 33 1 0
15 16 1 0
32 34 2 0
6 35 1 0
35 36 1 0
16 17 1 0
8 9 1 0
17 18 1 0
4 5 1 0
36 37 2 0
37 38 1 0
38 39 1 0
39 35 2 0
17 19 1 0
36 40 1 0
9 10 2 0
40 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 570.67Molecular Weight (Monoisotopic): 570.1937AlogP: 5.19#Rotatable Bonds: 10Polar Surface Area: 165.60Molecular Species: ZWITTERIONHBA: 6HBD: 6#RO5 Violations: 3HBA (Lipinski): 9HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.44CX Basic pKa: 11.50CX LogP: 2.62CX LogD: 2.62Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.11Np Likeness Score: -0.48
References 1. Kotian PL, Krishnan R, Rowland S, El-Kattan Y, Saini SK, Upshaw R, Bantia S, Arnold S, Babu YS, Chand P.. (2009) Design, parallel synthesis, and crystal structures of biphenyl antithrombotics as selective inhibitors of tissue factor FVIIa complex. Part 1: Exploration of S2 pocket pharmacophores., 17 (11): [PMID:19409795 ] [10.1016/j.bmc.2009.04.013 ]