| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| C276580-5mg | 5mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $58.90 |
Hh signaling inhibitor
| Synonyms | CYCLOPAMINE|11-Deoxojervine|4449-51-8|11-Deoxyjervine|Jervine, 11-deoxo-|CHEBI:4021|CHEMBL254129|DTXSID6043709|ZH658AJ192|NSC-734950|Cyclopamine Tartrate|(2'R,3S,3'R,3'aS,6'S,6aS,6bS,7'aR,11aS,11bR)-1,2,3,3'a,4,4',5',6,6',6a,6b,7,7',7'a,8,11,11a,11b-Octad |
|---|---|
| Specifications & Purity | ≥99% |
| Storage Temp | Protected from light,Store at -20°C,Desiccated |
| Shipped In | Dry ice |
| IUPAC Name | (3S,3'R,3'aS,6'S,6aS,6bS,7'aR,9R,11aS,11bR)-3',6',10,11b-tetramethylspiro[2,3,4,6,6a,6b,7,8,11,11a-decahydro-1H-benzo[a]fluorene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-ol |
|---|---|
| INCHI | InChI=1S/C27H41NO2/c1-15-11-24-25(28-14-15)17(3)27(30-24)10-8-20-21-6-5-18-12-19(29)7-9-26(18,4)23(21)13-22(20)16(27)2/h5,15,17,19-21,23-25,28-29H,6-14H2,1-4H3/t15-,17+,19-,20-,21-,23-,24+,25-,26-,27-/m0/s1 |
| InChi Key | QASFUMOKHFSJGL-LAFRSMQTSA-N |
| Canonical SMILES | CC1CC2C(C(C3(O2)CCC4C5CC=C6CC(CCC6(C5CC4=C3C)C)O)C)NC1 |
| Isomeric SMILES | C[C@H]1C[C@@H]2[C@H]([C@H]([C@]3(O2)CC[C@H]4[C@@H]5CC=C6C[C@H](CC[C@@]6([C@H]5CC4=C3C)C)O)C)NC1 |
| Alternate CAS | 4449-51-8 |
| PubChem CID | 442972 |
| NSC Number | 734950 |
| MeSH Entry Terms | cyclopamine |
| Molecular Weight | 411.62 |
Enter Lot Number to search for COA:
| Solubility | Supplied in ethanol (10 mM) |
|---|---|
| Sensitivity | air and light sensitive |
| Pictogram(s) | GHS08 |
|---|---|
| Signal | Warning |
| Hazard Statements | H341,H361 |
| Precautionary Statements | P280,P405,P501,P281,P203,P318 |
