The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-Methyl-2-(2,2,2-trifluoro-acetylamino)-pentanoic acid ((S)-1-{[(cyanomethyl-carbamoyl)-methyl]-carbamoyl}-ethyl)-amide ID: ALA100223
PubChem CID: 44332550
Max Phase: Preclinical
Molecular Formula: C15H22F3N5O4
Molecular Weight: 393.37
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)C(F)(F)F)C(=O)N[C@@H](C)C(=O)NCC(=O)NCC#N
Standard InChI: InChI=1S/C15H22F3N5O4/c1-8(2)6-10(23-14(27)15(16,17)18)13(26)22-9(3)12(25)21-7-11(24)20-5-4-19/h8-10H,5-7H2,1-3H3,(H,20,24)(H,21,25)(H,22,26)(H,23,27)/t9-,10-/m0/s1
Standard InChI Key: HMFOAWYQFBPUEI-UWVGGRQHSA-N
Molfile:
RDKit 2D
27 26 0 0 1 0 0 0 0 0999 V2000
0.4542 -3.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1750 -3.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3125 -3.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8875 -3.6542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0292 -3.2625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6000 -3.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4625 -3.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4542 -2.8667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1750 -3.6750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7500 -3.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7500 -3.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6042 -3.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1750 -2.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3125 -4.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4625 -2.4375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6000 -2.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6000 -4.5042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4500 -4.4750 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.2417 -2.8500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.2583 -3.2292 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.8917 -3.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3250 -3.2667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0375 -3.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3167 -2.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7500 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1125 -1.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3250 -1.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 6 1 0
4 2 1 0
5 3 1 0
6 4 1 0
7 10 1 0
8 11 3 0
9 7 1 0
10 5 1 0
11 23 1 0
12 21 1 0
13 2 2 0
14 3 2 0
15 7 2 0
6 16 1 1
17 12 2 0
18 1 1 0
19 1 1 0
20 1 1 0
21 9 1 0
22 12 1 0
23 22 1 0
24 16 1 0
10 25 1 6
26 24 1 0
27 24 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 393.37Molecular Weight (Monoisotopic): 393.1624AlogP: -0.66#Rotatable Bonds: 9Polar Surface Area: 140.19Molecular Species: NEUTRALHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.07CX Basic pKa: ┄CX LogP: -1.06CX LogD: -1.47Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.39Np Likeness Score: -1.01
References 1. Cornish JA, Murray H, Kemp GD, Gani D. (1995) Inhibitors of the adenovirus type 2 proteinase based on substrate-like tetrapeptide nitriles, 5 (1): [10.1016/0960-894X(94)00452-L ]