[(S)-1-((S)-1-{[(2,2-Dimethoxy-ethylcarbamoyl)-methyl]-carbamoyl}-ethylcarbamoyl)-3-methyl-butyl]-carbamic acid benzyl ester

ID: ALA100228

PubChem CID: 44332582

Max Phase: Preclinical

Molecular Formula: C23H36N4O7

Molecular Weight: 480.56

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(CNC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1)OC

Standard InChI:  InChI=1S/C23H36N4O7/c1-15(2)11-18(27-23(31)34-14-17-9-7-6-8-10-17)22(30)26-16(3)21(29)25-12-19(28)24-13-20(32-4)33-5/h6-10,15-16,18,20H,11-14H2,1-5H3,(H,24,28)(H,25,29)(H,26,30)(H,27,31)/t16-,18-/m0/s1

Standard InChI Key:  RJUNDKRLCTZQKT-WMZOPIPTSA-N

Molfile:  

     RDKit          2D

 34 34  0  0  1  0  0  0  0  0999 V2000
    3.9667   -7.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6792   -7.5292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8250   -7.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1125   -7.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2542   -7.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5375   -7.9250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8292   -7.9417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4000   -7.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2542   -7.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9750   -7.5417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9625   -8.7625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8292   -6.6792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1125   -6.7042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1042   -7.9167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2542   -6.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2542   -8.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5417   -7.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4042   -7.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6875   -7.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3917   -7.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3208   -7.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1167   -7.9625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4042   -6.7167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9667   -6.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4000   -8.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0333   -7.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3208   -8.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1167   -6.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8292   -7.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9750   -5.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7667   -6.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0333   -9.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7458   -7.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7500   -8.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  6  1  0
  4  8  1  0
  5  1  1  0
  6  5  1  0
  7  4  1  0
  8  2  1  0
  9 17  1  0
 10  9  1  0
 11  1  2  0
 12  3  2  0
 13  4  2  0
 14  3  1  0
  5 15  1  1
 16  9  2  0
 17  7  1  0
 18 19  1  0
 19 10  1  0
 20 14  1  0
 21 20  1  0
 22 18  1  0
 23 18  1  0
 24 15  1  0
  8 25  1  6
 26 21  2  0
 27 21  1  0
 28 23  1  0
 29 22  1  0
 30 24  1  0
 31 24  1  0
 32 27  2  0
 33 26  1  0
 34 32  1  0
 33 34  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA100228

   benzyl N-[(2S)-1-[[(2S)-1-[[2-(2,2-dimethoxyethylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 480.56

Molecular Weight (Monoisotopic): 480.2584

AlogP: 0.68

#Rotatable Bonds: 14

Polar Surface Area: 144.09

Molecular Species: NEUTRAL

HBA: 7

HBD: 4

#RO5 Violations: ┄

HBA (Lipinski): 11

HBD (Lipinski): 4

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 12.08

CX Basic pKa: ┄

CX LogP: 0.84

CX LogD: 0.84

Aromatic Rings: 1

Heavy Atoms: 34

QED Weighted: 0.29

Np Likeness Score: -0.60

References

1. Cornish JA, Murray H, Kemp GD, Gani D.  (1995)  Inhibitors of the adenovirus type 2 proteinase based on substrate-like tetrapeptide nitriles,  5  (1): [10.1016/0960-894X(94)00452-L]

Source

Source(1):

• Scientific Literature