The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[(S)-1-((S)-1-{[(2,2-Dimethoxy-ethylcarbamoyl)-methyl]-carbamoyl}-ethylcarbamoyl)-3-methyl-butyl]-carbamic acid tert-butyl ester ID: ALA100630
PubChem CID: 44332583
Max Phase: Preclinical
Molecular Formula: C20H38N4O7
Molecular Weight: 446.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(CNC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)OC(C)(C)C)OC
Standard InChI: InChI=1S/C20H38N4O7/c1-12(2)9-14(24-19(28)31-20(4,5)6)18(27)23-13(3)17(26)22-10-15(25)21-11-16(29-7)30-8/h12-14,16H,9-11H2,1-8H3,(H,21,25)(H,22,26)(H,23,27)(H,24,28)/t13-,14-/m0/s1
Standard InChI Key: PNESGNHHMRVOFW-KBPBESRZSA-N
Molfile:
RDKit 2D
31 30 0 0 1 0 0 0 0 0999 V2000
3.1917 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0542 -0.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9125 -0.8542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7667 -1.2500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3417 -0.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4792 -0.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0542 -1.2667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6292 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4875 -1.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3375 -1.2417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0542 -0.0042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2042 -0.8667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1917 -2.0875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3417 -0.0292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4792 -0.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4792 -2.1000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3750 -0.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7750 -0.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6292 -0.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9167 -1.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3417 -1.2875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6292 -0.0417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2000 0.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6292 -2.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0958 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3708 -0.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1708 -1.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3500 0.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0625 -0.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2042 1.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9917 0.6083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 1 1 0
4 6 1 0
5 8 1 0
6 1 1 0
7 5 1 0
8 3 1 0
9 18 1 0
10 2 1 0
11 2 2 0
12 9 1 0
13 1 2 0
14 5 2 0
6 15 1 1
16 9 2 0
17 10 1 0
18 7 1 0
19 20 1 0
20 12 1 0
21 19 1 0
22 19 1 0
23 15 1 0
8 24 1 6
25 17 1 0
26 17 1 0
27 17 1 0
28 22 1 0
29 21 1 0
30 23 1 0
31 23 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.55Molecular Weight (Monoisotopic): 446.2740AlogP: 0.28#Rotatable Bonds: 12Polar Surface Area: 144.09Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.08CX Basic pKa: ┄CX LogP: 0.17CX LogD: 0.17Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.32Np Likeness Score: -0.67
References 1. Cornish JA, Murray H, Kemp GD, Gani D. (1995) Inhibitors of the adenovirus type 2 proteinase based on substrate-like tetrapeptide nitriles, 5 (1): [10.1016/0960-894X(94)00452-L ]