The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
{2-[(S)-2-((S)-2-Benzyloxycarbonylamino-4-methyl-pentanoylamino)-propionylamino]-acetylamino}-acetic acid ethyl ester ID: ALA101197
PubChem CID: 44332640
Max Phase: Preclinical
Molecular Formula: C23H34N4O7
Molecular Weight: 478.55
Molecule Type: Protein
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)CNC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1
Standard InChI: InChI=1S/C23H34N4O7/c1-5-33-20(29)13-24-19(28)12-25-21(30)16(4)26-22(31)18(11-15(2)3)27-23(32)34-14-17-9-7-6-8-10-17/h6-10,15-16,18H,5,11-14H2,1-4H3,(H,24,28)(H,25,30)(H,26,31)(H,27,32)/t16-,18-/m0/s1
Standard InChI Key: AUOPJDONCZTWFS-WMZOPIPTSA-N
Molfile:
RDKit 2D
34 34 0 0 1 0 0 0 0 0999 V2000
3.1292 -7.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8417 -7.3750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9875 -7.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2750 -7.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4167 -7.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7000 -7.7667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9917 -7.7875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5625 -7.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4167 -7.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5667 -7.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1375 -7.3792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1250 -8.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9917 -6.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2750 -6.5500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2667 -7.7625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4167 -6.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4167 -8.6167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5667 -6.5625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7042 -7.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8500 -7.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4458 -7.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2792 -7.8042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1583 -7.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1292 -6.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5625 -8.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9917 -7.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8708 -7.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1583 -8.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9292 -5.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1375 -5.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7042 -7.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5833 -7.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8708 -8.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5875 -8.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 6 1 0
4 8 1 0
5 1 1 0
6 5 1 0
7 4 1 0
8 2 1 0
9 19 1 0
10 20 1 0
11 9 1 0
12 1 2 0
13 3 2 0
14 4 2 0
15 3 1 0
5 16 1 1
17 9 2 0
18 10 2 0
19 7 1 0
20 11 1 0
21 15 1 0
22 10 1 0
23 21 1 0
24 16 1 0
8 25 1 6
26 22 1 0
27 23 2 0
28 23 1 0
29 24 1 0
30 24 1 0
31 26 1 0
32 27 1 0
33 28 2 0
34 33 1 0
32 34 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.55Molecular Weight (Monoisotopic): 478.2427AlogP: 0.63#Rotatable Bonds: 13Polar Surface Area: 151.93Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.86CX Basic pKa: ┄CX LogP: 0.59CX LogD: 0.59Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -0.67
References 1. Cornish JA, Murray H, Kemp GD, Gani D. (1995) Inhibitors of the adenovirus type 2 proteinase based on substrate-like tetrapeptide nitriles, 5 (1): [10.1016/0960-894X(94)00452-L ]